| Primary information |
|---|
| ID | 20480 |
| Pubchem ID | 119207 |
| Name | Testosterone sulfate |
| Description | Testosterone is a predominantly male hormone; though females do produce certain amounts of it. The primary female hormone is estrogen and males also produce certain amounts of this hormone. |
| Synonym | Testosterone-17beta-sulfate;Testosterone-17b-sulfate;Testosterone-17b-sulfuric acid;Testosterone-17b-sulphate;Testosterone-17b-sulphuric acid;Testosterone-17beta-sulfuric acid;Testosterone-17beta-sulp |
| Molecular Weight | 368.488 |
| Formula | C19H28O5S |
| IUPAC | [(1S;2R;10R;11S;14S;15S)-2;15-dimethyl-5-oxotetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-6-en-14-yl]oxidanesulfonic acid |
| SMILE | [H][C@@]12CC[C@H](OS(O)(=O)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0002833 |
| Melting Point (Degree C) | 155 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|