| Primary information |
|---|
| ID | 20479 |
| Pubchem ID | 5280880 |
| Name | Prostaglandin A2 |
| Description | Produced by the seminal vesicles; prostaglandins are a group of lipid compounds that are derived enzymatically from fatty acids. Technically hormones; the prostanoid class of fatty acid derivatives is a subclass of eicosanoids. |
| Synonym | (15S)-PGA2;(15S)-Prostaglandin a2;5;6-cis-PGA2;Medullin;PGA2;7-[2-(3-Hydroxy-1-octenyl)-5-oxo-3-cyclopenten-1-yl]-5-heptenoic acid;(5Z;13E;15S)-15-Hydroxy-9-oxoprosta-5;10;13-trien-1-Oic acid;(+)-Pros |
| Molecular Weight | 334.4498 |
| Formula | C20H30O4 |
| IUPAC | (5Z)-7-[(1R;2S)-2-[(1E;3S)-3-hydroxyoct-1-en-1-yl]-5-oxocyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILE | CCCCC[C@H](O)C=C[C@H]1C=CC(=O)[C@@H]1CC=C/CCCC(O)=O |
| PDB ID | NA |
| KEGG | C05953 |
| HMDB ID | HMDB0002752 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | P70263; P43115 |
| Reference | HMDB
|