| Primary information |
|---|
| ID | 20475 |
| Pubchem ID | 3034666 |
| Name | Cholesta-4;6-dien-3-one |
| Description | Cholesta-4;6-dien-3-one is a product of the oxidation of cholesteral. It may be metabolized to 4-cholesten-3-one and cholestanol by liver; adrenals and brain. An accumulation of cholesta-4;6-dien-3-one is found in serum of patients with cerebrotendinous xanthomatosis |
| Synonym | 4;6-Cholestadien-3-one;4;6-Cholestadiene-3-one;Cholest-4;6-dien-3-one;Cholesta-4;6-diene-3-one;4;6-Cholestadien-3-one;4;6-Cholestadiene-3-one;Cholest-4;6-dien-3-one;Cholesta-4;6-diene-3-one;4;6-Choles |
| Molecular Weight | 382.6218 |
| Formula | C27H42O |
| IUPAC | (1S;2R;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-6;8-dien-5-one |
| SMILE | [H][C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])C=CC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0002394 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|