| Primary information |
|---|
| ID | 20473 |
| Pubchem ID | 5281326 |
| Name | Isofucosterol |
| Description | Isofucosterol; also known as delta5-avenasterol; is a phytosterol. Phytosterols; or plant sterols; are compounds that occur naturally and bear a close structural resemblance to cholesterol but have different side-chain configurations. |
| Synonym | (24Z)-24-Ethylcholesta-5;24(28)-dien-3beta-ol;(24Z)-Ethylidenecholesterol;(3beta)-Stigmasta-5;24(28)-dien-3-ol;(3beta;24Z)-Stigmasta-5;24(28)-dien-3-ol;(Z)-24-Ethylcholesta-5;24(28)-dien-3beta-ol;(Z)- |
| Molecular Weight | 412.702 |
| Formula | C29H48O |
| IUPAC | (1S;2R;5S;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R;5Z)-5-(propan-2-yl)hept-5-en-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-ol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(=CC)C(C)C |
| PDB ID | NA |
| KEGG | C08821 |
| HMDB ID | HMDB0002374 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|