| Primary information |
|---|
| ID | 20470 |
| Pubchem ID | NA |
| Name | 5b-Cholestane-3a;7a;12a;25;26-pentol |
| Description | 5b-Cholestane-3a;7a;12a;25;26-pentol is a bile alcohol. Bile alcohols have been found to be present as minor components in the bile and urine in healthy subjects. Bile alcohols are end products for cholesterol elimination as well as major biliary constituents; in mammals; cholesterol is metabolized |
| Synonym | 3alpha;7alpha;12alpha;25;27-Pentahydroxy-5beta-cholestane;5beta-Cholestane-3alpha;7alpha;12alpha;25;26-pentol;5β-cholestane-3α;7α;12α;25;26-pentol;5 beta-Bufol;Cholestane-3;7;12;25;26-pentol;3alpha;7a |
| Molecular Weight | 452.667 |
| Formula | C27H48O5 |
| IUPAC | (1S;2S;5R;7S;9R;10R;11S;14R;15R;16S)-14-[(2R)-6;7-dihydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecane-5;9;16-triol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCCC(C)(O)CO |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0002180 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|