| Primary information |
|---|
| ID | 20469 |
| Pubchem ID | 196302 |
| Name | 27-Norcholestanehexol |
| Description | 27-Norcholestanehexol is a bile alcohol. Bile alcohols have been found to be present as minor components in the bile and urine in healthy subjects. |
| Synonym | 27-N-5-CH;27-Nor-5beta-cholestane- 3alpha;7alpha;12alpha;24alpha;24xi;25xi;26-hexol;27-Norcholestane-3;7;12;24;25;26-hexol;27-N-5-CH;27-Nor-5beta-cholestane- 3alpha;7alpha;12alpha;24alpha;24xi;25xi;26 |
| Molecular Weight | 454.6398 |
| Formula | C26H46O6 |
| IUPAC | (1S;2S;5R;7S;9R;10R;11S;14R;15R;16S)-2;15-dimethyl-14-[(2R)-5;6;7-trihydroxyheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecane-5;9;16-triol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCC(O)C(O)CO |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0002157 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|