| Primary information |
|---|
| ID | 20468 |
| Pubchem ID | 21252278 |
| Name | 27-Nor-5b-cholestane-3a;7a;12a;24;25-pentol |
| Description | 27-Nor-5b-cholestane-3a;7a;12a;24;25-pentol; also known as 27-nor-pentol or 27-NC-3;7;12;24;25-po; belongs to the class of organic compounds known as pentahydroxy bile acids; alcohols and derivatives. These are bile acids; alcohols or derivatives bearing five hydroxyl groups. |
| Synonym | 27-Nor-pentol;26(Or 27)-norcholestane-3;7;12;24;25-pentol;27-NC-3;7;12;24;25-PO;27-Nor-5beta-cholestane-3alpha;7alpha;12alpha;24xi;25xi-pentol;27-Nor-5 beta-cholestane-3 alpha;7 alpha;12 alpha;24;25-p |
| Molecular Weight | 438.6404 |
| Formula | C26H46O5 |
| IUPAC | (1S;2S;5R;7S;9R;10R;11S;14R;15R;16S)-14-[(2R)-5;6-dihydroxyheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecane-5;9;16-triol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCC(O)C(C)O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0002126 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|