| Primary information |
|---|
| ID | 20467 |
| Pubchem ID | 123976 |
| Name | 27-Hydroxycholesterol |
| Description | 27-Hydroxycholesterol (27-HC); also known as (25R)-cholest-5-ene-3β;26-diol or by its conventional name 26-hydroxycholesterol; is an oxygenated derivative of cholesterol and a major oxysterol in circulation |
| Synonym | (25R)-26-Hydroxycholesterol;5-Cholestene-3beta;27-diol;Cholest-5-ene-3beta;27-diol;5-Cholestene-3b;27-diol;5-Cholestene-3β;27-diol;Cholest-5-ene-3b;27-diol;Cholest-5-ene-3β;27-diol;(25R)-Cholest-5-ene |
| Molecular Weight | 402.6529 |
| Formula | C27H46O2 |
| IUPAC | (1S;2R;5S;10S;11S;14R;15R)-14-[(2R;6R)-7-hydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-ol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC[C@@H](C)CO |
| PDB ID | NA |
| KEGG | C06340 |
| HMDB ID | HMDB0002103 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|