| Primary information |
|---|
| ID | 20458 |
| Pubchem ID | 160520 |
| Name | 5beta-Cholestane-3alpha;7alpha;12alpha-triol |
| Description | 5beta-Cholestane-3alpha;7alpha;12alpha-triol is an intermediate in bile acid biosynthesis. 5beta-Cholestane-3alpha;7alpha;12alpha-triol is the second to last step in the synthesis of 5beta-cyprinolsulfate. |
| Synonym | 3alpha;7alpha;12alpha-Trihydroxy-5beta-cholestane;3alpha;7alpha;12alpha-Trihydroxycoprostane;3a;7a;12a-Trihydroxy-5b-cholestane;3Α;7α;12α-trihydroxy-5β-cholestane;3a;7a;12a-Trihydroxycoprostane;3Α;7α; |
| Molecular Weight | 420.6682 |
| Formula | C27H48O3 |
| IUPAC | (1S;2S;5R;7S;9R;10R;11S;14R;15R;16S)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;9;16-triol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C05454 |
| HMDB ID | HMDB0001457 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|