| Primary information |
|---|
| ID | 20456 |
| Pubchem ID | 133187 |
| Name | 4;4-Dimethyl-14a-formyl-5a-cholesta-8;24-dien-3b-ol |
| Description | 4;4-Dimethyl-14a-formyl-5a-cholesta-8;24-dien-3b-ol; also known as 32-ketolanosterol; belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. 4;4-Dimethyl-14a-formyl-5a-cholesta-8;24-dien-3b-ol is an extremely weak basic (essential |
| Synonym | 4;4-Dimethyl-14-alpha-formyl-5-alpha-cholesta-8;24-dien-3-beta-ol;32-Ketolanosterol;32-Oxolanosterol;4;4-Dimethyl-14-alpha-formyl-5-alpha-cholesta-8;24-dien-3-beta-ol;32-Ketolanosterol;32-Oxolanostero |
| Molecular Weight | 440.7009 |
| Formula | C30H48O2 |
| IUPAC | (2S;5S;11S;14R;15R)-5-hydroxy-2;6;6;15-tetramethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-1(10)-ene-11-carbaldehyde |
| SMILE | [H][C@@]1(CC[C@@]2(C=O)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)C1CC3)[C@H](C)CCC=C(C)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0001421 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|