| Primary information |
|---|
| ID | 20455 |
| Pubchem ID | 53477727 |
| Name | 25;26-dihydroxyvitamin D |
| Description | 25;26-(OH)2D3 is a renal microsomal 25-OH-D3 metabolite; whose plasma concentration increases during vitamin D excess concomitantly with an increase in the concentration of lactone. This observation considered with the related structural features of 25;26-(OH)2D3 and lactone (both are oxidized at (C |
| Synonym | 25;26-Dihydroxycholecalciferol;25;26-Dihydroxyvitamin D3;9;10-Secocholesta-5;7;10(19)-triene-3b;25;26-triol;25;26-Dihydroxycholecalciferol;25;26-Dihydroxyvitamin D3;9;10-Secocholesta-5;7;10(19)-triene |
| Molecular Weight | 416.6365 |
| Formula | C27H44O3 |
| IUPAC | (6R)-6-[(1R;3aS;5Z;7aS)-5-{2-[(1Z;5S)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene}-7a-methyl-octahydro-1H-inden-1-yl]-2-methylheptane-1;2-diol |
| SMILE | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(O)CO)[C@@]1(C)CCC(C2)=CC=C1C[C@@H](O)CCC1=C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0001420 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|