| Primary information |
|---|
| ID | 20454 |
| Pubchem ID | 24316 |
| Name | Cyclic GMP |
| Description | Cyclic GMP; also known as CGMP or 3';5'-cyclic GMP; belongs to the class of organic compounds known as 3';5'-cyclic purine nucleotides. These are purine nucleotides in which the oxygen atoms linked to the C3 and C5 carbon atoms of the ribose moiety are both bonded the same phosphorus atom of the pho |
| Synonym | CGMP;Guanosine 3';5'-cyclic monophosphate;Guanosine 3';5'-cyclic phosphate;Guanosine cyclic monophosphate;Guanosine 3';5'-cyclic monophosphoric acid;Guanosine 3';5'-cyclic phosphoric acid;Guanosine cy |
| Molecular Weight | 345.2053 |
| Formula | C10H12N5O7P |
| IUPAC | 9-[(4aR;6R;7R;7aS)-2;7-dihydroxy-2-oxo-hexahydro-2λ⁵-furo[3;2-d][1;3;2]dioxaphosphinin-6-yl]-2-amino-6;9-dihydro-1H-purin-6-one |
| SMILE | NC1=NC2=C(N=CN2[C@@H]2O[C@@H]3COP(O)(=O)O[C@H]3[C@H]2O)C(=O)N1 |
| PDB ID | NA |
| KEGG | C00942 |
| HMDB ID | HMDB0001314 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | Q9HUK7 |
| Reference | HMDB
|