| Primary information |
|---|
| ID | 20453 |
| Pubchem ID | 50990081 |
| Name | 4;4-Dimethyl-5a-cholesta-8;24-dien-3-b-ol |
| Description | 4;4-Dimethyl-5a-cholesta-8;24-dien-3-b-ol (14-demethyllanosterol) is an intermediate in sterol biosynthesis. In particular; it is an intermediate in the conversion of lanosterol to zymosterol. 4;4-Dimethyl-5a-cholesta-8;24-dien-3-b-ol is a substrate for C-4 methyl sterol oxidase. |
| Synonym | (3beta;5alpha)-4;4-Dimethylcholesta-8;24-dien-3-ol;14-Demethyllanosterol;4;4-Dimethyl-5 alpha -cholesta-8;24-dien-3 beta -ol;4;4-Dimethyl-5-alpha-cholesta-(8;24)-dien-3-beta-ol;4;4-Dimethyl-5-alpha-ch |
| Molecular Weight | 412.6908 |
| Formula | C29H48O |
| IUPAC | (2S;5S;7R;11R;15R)-2;6;6;15-tetramethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-1(10)-en-5-ol |
| SMILE | [H][C@@]12CCC([C@H](C)CCC=C(C)C)[C@@]1(C)CCC1=C2CC[C@@]2([H])C(C)(C)[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C05108 |
| HMDB ID | HMDB0001286 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|