| Primary information |
|---|
| ID | 20452 |
| Pubchem ID | 65252 |
| Name | Obtusifoliol |
| Description | Obtusifoliol belongs to the class of organic compounds known as ergosterols and derivatives. These are steroids containing ergosta-5;7;22-trien-3beta-ol or a derivative thereof; which is based on the 3beta-hydroxylated ergostane skeleton. |
| Synonym | 4alpha;14alpha-Dimethyl-5alpha-ergosta-8;24(28)-dien-3beta-ol;4alpha;14alpha-Dimethyl-24-methylene-5alpha-cholesta-8-en-3beta-ol;4a;14a-Dimethyl-5a-ergosta-8;24(28)-dien-3b-ol;4α;14α-Dimethyl-5α-ergos |
| Molecular Weight | 426.7174 |
| Formula | C30H50O |
| IUPAC | (2S;5S;6S;7S;11R;14R;15R)-2;6;11;15-tetramethyl-14-[(2R)-6-methyl-5-methylideneheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-1(10)-en-5-ol |
| SMILE | [H][C@@]1(CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)[C@@H](C)[C@]1([H])CC3)[C@H](C)CCC(=C)C(C)C |
| PDB ID | NA |
| KEGG | C01943 |
| HMDB ID | HMDB0001242 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|