| Primary information |
|---|
| ID | 20451 |
| Pubchem ID | 193321 |
| Name | 27-Deoxy-5b-cyprinol |
| Description | 27-Deoxy-5b-cyprinol is an intermediate in Bile acid synthesis pathway; in a sequence of reactions catalyzed by sterol 27-hydroxylase (CYP27) in the oxidation of 5 beta-cholestane-3 alpha;7 alpha;12 alpha;27-tetrol into 3 alpha;7 alpha;12 alpha-trihydroxy-5 beta-cholestanoic acid |
| Synonym | (3alpha;5beta;7alpha;12alpha)-Cholestane-3;7;12;26-tetrol;3alpha;7alpha;12alpha;26-Tetrahydroxy-5beta-cholestane;5beta-Cholestane 3alpha;7alpha;12alpha;27-tetrol;5beta-Cholestane-3alpha;7alpha;12alpha |
| Molecular Weight | 436.6676 |
| Formula | C27H48O4 |
| IUPAC | (1S;2S;5R;7S;9R;10R;11S;14R;15R;16S)-14-[(2R)-7-hydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecane-5;9;16-triol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCCC(C)CO |
| PDB ID | NA |
| KEGG | C05446 |
| HMDB ID | HMDB0001231 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|