| Primary information |
|---|
| ID | 20450 |
| Pubchem ID | 656456 |
| Name | 4a-Formyl-5a-cholesta-8;24-dien-3b-ol |
| Description | 4a-Formyl-5a-cholesta-8;24-dien-3b-ol belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. 4a-Formyl-5a-cholesta-8;24-dien-3b-ol is an extremely weak basic (essentially neutral) compou |
| Synonym | 4alpha-Formyl-5alpha-cholesta-8;24-dien-3beta -ol;4alpha-Formyl-5alpha-cholesta-8;24-dien-3beta -ol; |
| Molecular Weight | 412.6478 |
| Formula | C28H44O2 |
| IUPAC | 5-hydroxy-2;15-dimethyl-14-(6-methylhept-5-en-2-yl)tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-1(10)-ene-6-carbaldehyde |
| SMILE | CC(CCC=C(C)C)C1CCC2C3=C(CCC12C)C1(C)CCC(O)C(C=O)C1CC3 |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0001203 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|