| Primary information |
|---|
| ID | 20449 |
| Pubchem ID | 22833560 |
| Name | 5a-Cholesta-8;24-dien-3-one |
| Description | 5a-Cholesta-8;24-dien-3-one belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. 5a-Cholesta-8;24-dien-3-one is an extremely weak basic (essentially neutral) compound (based on its pKa |
| Synonym | 5alpha-Cholesta-8;24-dien-3-one;5alpha-Cholesta-8;24-dien-3-one; |
| Molecular Weight | 382.6218 |
| Formula | C27H42O |
| IUPAC | (2S;11R;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-1(10)-en-5-one |
| SMILE | [H][C@@]12CC[C@H]([C@H](C)CCC=C(C)C)[C@@]1(C)CCC1=C2CCC2CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0001093 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|