| Primary information |
|---|
| ID | 20447 |
| Pubchem ID | 443212 |
| Name | 4;4-Dimethylcholesta-8;14;24-trienol |
| Description | 4;4-Dimethylcholesta-8;14;24-trienol is a product of the enzyme delta14-sterol reductase [EC 1.3.1.70] (KEGG). It is involved in the biosynthesis of steroids and is involved in the conversion of lanosterol to zymosterol. |
| Synonym | 4;4-Dimechol-8;14;24-trienol;4;4-Dimethylcholesta-8(9);14;24-trien-3beta-ol;4;4-Dimethylcholesta-8(9);14;24-trien-3b-ol;4;4-Dimethylcholesta-8(9);14;24-trien-3β-ol;FF-MAS;Follicular fluid meiosis acti |
| Molecular Weight | 410.6749 |
| Formula | C29H46O |
| IUPAC | (2S;5S;7R;14R;15R)-2;6;6;15-tetramethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-1(10);11-dien-5-ol |
| SMILE | C[C@H](CCC=C(C)C)[C@H]1CC=C2C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3 |
| PDB ID | NA |
| KEGG | C11455 |
| HMDB ID | HMDB0001023 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|