| Primary information |
|---|
| ID | 20442 |
| Pubchem ID | 5864 |
| Name | Tetrahydrocortisol |
| Description | Tetrahydrocortisol; also known as urocortisol; belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. Thus; tetrahydrocortisol is considered to be a steroid. Based on a literature review a signif |
| Synonym | 3alpha;5beta-Tetrahydrocortisol;5beta-Pregnane-3alpha;11beta;17alpha;21-tetrol-20-one;5beta-Tetrahydrocortisol;Tetrahydrohydrocortisone;Urocortisol;3a;5b-Tetrahydrocortisol;3Α;5β-tetrahydrocortisol;5b |
| Molecular Weight | 366.4917 |
| Formula | C21H34O5 |
| IUPAC | 2-hydroxy-1-[(2S;5R;14R;15S;17S)-5;14;17-trihydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecan-14-yl]ethan-1-one |
| SMILE | C[C@]12C[C@H](O)C3C(CCC4C[C@H](O)CC[C@]34C)C1CC[C@]2(O)C(=O)CO |
| PDB ID | NA |
| KEGG | C05472 |
| HMDB ID | HMDB0000949 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|