Primary information |
---|
ID | 20441 |
Pubchem ID | 440663 |
Name | Cholest-5-ene |
Description | Cholest-5-ene; also known as 5-cholestene; belongs to the class of organic compounds known as cholestane steroids. These are steroids with a structure containing the 27-carbon cholestane skeleton. Thus; cholest-5-ene is considered to be a sterol. Based on a literature review a significant number of |
Synonym | 5-Cholestene;D5-Cholestene;Cholest-5-ene;5-Cholestene;D5-Cholestene;Cholest-5-ene;D5-Cholestene;Cholest-5-ene |
Molecular Weight | 370.6541 |
Formula | C27H46 |
IUPAC | (1S;2R;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-ene |
SMILE | [H][C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2CCCC[C@]12C |
PDB ID | NA |
KEGG | C05416 |
HMDB ID | HMDB0000941 |
Melting Point (Degree C) | NA |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|