| Primary information |
|---|
| ID | 20440 |
| Pubchem ID | 168408 |
| Name | Tauro-b-muricholic acid |
| Description | Tauro-b-muricholic acid is a bile acid. Bile acids are steroid acids found predominantly in the bile of mammals. The distinction between different bile acids is minute; depending only on the presence or absence of hydroxyl groups on positions 3; 7; and 12. |
| Synonym | Tauro-b-muricholate;N-(3a;6b;7b-Trihydroxy-5b-cholan-24-oyl)-taurine;Tauro-beta-muricholate;Tauro-beta-muricholic acid;T-alpha-MC;T-beta-MC;Tauro-alpha-muricholate;Tauro-alpha-muricholic acid;Tauromur |
| Molecular Weight | 515.703 |
| Formula | C26H45NO7S |
| IUPAC | 2-[(4R)-4-[(2R;5R;7R;8S;9R;14R;15R)-5;8;9-trihydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecan-14-yl]pentanamido]ethane-1-sulfonic acid |
| SMILE | [H][C@@]12C[C@H](O)CC[C@]1(C)C1CC[C@]3(C)[C@H](CCC3C1[C@@H](O)[C@H]2O)[C@H](C)CCC(=O)NCCS(O)(=O)=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000932 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|