Primary information |
---|
ID | 20438 |
Pubchem ID | 440105 |
Name | 11a-Hydroxyprogesterone |
Description | Progesterone is a C-21 steroid hormone involved in the female menstrual cycle; pregnancy (supports gestation) and embryogenesis of humans and other species. Progesterone belongs to a class of hormones called progestagens; and is the major naturally occurring human progestagen. |
Synonym | 11-Hydroxyprogesterone;11a-Hydroxy-pregn-4-ene-3;20-dione;11a-Hydroxy-progesterone;11a-Hydroxypregn-4-ene-3;20-dione;4-Pregnene-11a-ol-3;20-dione;Pregn-4-en-11a-ol-3;20-dione;11Α-hydroxyprogesterone;1 |
Molecular Weight | 330.4611 |
Formula | C21H30O3 |
IUPAC | (1S;2R;10S;11S;15S;17R)-14-acetyl-17-hydroxy-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-en-5-one |
SMILE | [H][C@@]12CCC(C(C)=O)[C@@]1(C)C[C@@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
PDB ID | NA |
KEGG | C03747 |
HMDB ID | HMDB0000920 |
Melting Point (Degree C) | 222 |
Water Solubility | 0.05 mg/mL |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|