| Primary information |
|---|
| ID | 20437 |
| Pubchem ID | 50938266 |
| Name | CE(18:1(9Z)) |
| Description | Cholesteryl oleate is an ester of cholesterol. Fatty acid esters of cholesterol constitute about two-thirds of the cholesterol in the plasma. Cholesterol is a sterol (a combination steroid and alcohol) and a lipid found in the cell membranes of all body tissues; and transported in the blood plasma o |
| Synonym | 1-Oleoyl-cholesterol;18:1(9Z) Cholesterol ester;3beta-Hydroxy-5-cholestene 3-oleate;5-Cholesten-3b-ol 3-oleate;CE(18:1);CE(18:1/0:0);CE(18:1n9/0:0);CE(18:1W9/0:0);Cholest-5-en-3-beta-yl oleate;Cholest |
| Molecular Weight | 651.117 |
| Formula | C45H78O2 |
| IUPAC | (2R;5S;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-yl (9Z)-octadec-9-enoate |
| SMILE | CCCCCCCCC=C/CCCCCCCC(=O)O[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(CCC4C3CC=C2C1)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C14641 |
| HMDB ID | HMDB0000918 |
| Melting Point (Degree C) | 94 |
| Water Solubility | 3 mg/mL |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|