| Primary information |
|---|
| ID | 20436 |
| Pubchem ID | 6665 |
| Name | 5alpha-Cholestanol |
| Description | 5alpha-Cholestanol; also known as cholestanol or dihydrocholesterol; belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. |
| Synonym | (3beta;5alpha)-Cholestan-3-ol;Cholestanol;Dihydrocholesterol;Zymostanol;(3b;5a)-Cholestan-3-ol;(3Β;5α)-cholestan-3-ol;5a-Cholestanol;5Α-cholestanol;5 alpha Cholestan 3 beta ol;5 beta Cholestan 3 beta |
| Molecular Weight | 388.6694 |
| Formula | C27H48O |
| IUPAC | (1S;2S;5S;7S;10R;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecan-5-ol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@@]4([H])C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000908 |
| Melting Point (Degree C) | 140 |
| Water Solubility | 0.00034 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|