| Primary information |
|---|
| ID | 20435 |
| Pubchem ID | 12444617 |
| Name | Tetrahydrocortisone |
| Description | Cortisol is a corticosteroid hormone that is involved in the response to stress; it increases blood pressure and blood sugar levels and suppresses the immune system. |
| Synonym | (3a;5b)-3;17;21-Trihydroxy-pregnane-11;20-dione;3;17-Dihydroxy-17-hydroxyacetyl-10;13-dimethyl-hexadecahydro-cyclopenta[a]phenanthren-11-one;3a;17;21-Trihydroxy-5a-pregnane-11;20-dione;3a;17;21-Trihyd |
| Molecular Weight | 364.4758 |
| Formula | C21H32O5 |
| IUPAC | (1S;2S;5S;7S;10S;11S;14R;15S)-5;14-dihydroxy-14-(2-hydroxyacetyl)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecan-17-one |
| SMILE | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000903 |
| Melting Point (Degree C) | 190 |
| Water Solubility | 203.2 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|