Primary information |
---|
ID | 20434 |
Pubchem ID | 222865 |
Name | Androstanedione |
Description | Androstanedione belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. |
Synonym | 5alpha-Androstan-3;17-dione;5a-Androstan-3;17-dione;5Α-androstan-3;17-dione;(5a)-Androstane-3;17-dione;5-alpha-Androstane-3;17-dione;5a-Androsta-3;17-dione;5a-Androstane-3; 17-dione;5a-Androstane-3;17 |
Molecular Weight | 288.4244 |
Formula | C19H28O2 |
IUPAC | (1S;2S;7S;10R;11S;15S)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;14-dione |
SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C |
PDB ID | NA |
KEGG | C00674 |
HMDB ID | HMDB0000899 |
Melting Point (Degree C) | 133.5 |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|