| Primary information |
|---|
| ID | 20431 |
| Pubchem ID | 5280795 |
| Name | Vitamin D3 |
| Description | Vitamin D3; also called cholecalciferol; is one of the forms of vitamin D. Vitamin D3 is a steroid hormone that has long been known for its important role in regulating body levels of calcium and phosphorus; in mineralization of bone; and for the assimilation of Vitamin A. |
| Synonym | (+)-Vitamin D3;(1S;3Z)-3-[(2E)-2-[(1R;3AR;7as)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-2;3;3a;5;6;7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidene-cyclohexan-1-ol;(3beta;5Z;7E)-9;10-Secocholest |
| Molecular Weight | 384.6377 |
| Formula | C27H44O |
| IUPAC | (1S;3Z)-3-{2-[(1R;3aS;4E;7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-octahydro-1H-inden-4-ylidene]ethylidene}-4-methylidenecyclohexan-1-ol |
| SMILE | [H][C@@]1(CC[C@@]2([H])C(CCC[C@]12C)=CC=C1C[C@@H](O)CCC1=C)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C05443 |
| HMDB ID | HMDB0000876 |
| Melting Point (Degree C) | 84.5 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|