| Primary information |
|---|
| ID | 20430 |
| Pubchem ID | 92128 |
| Name | 5alpha-Cholestanone |
| Description | 5alpha-Cholestanone; also known as 5α-cholestanone; belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. |
| Synonym | 5a-Cholestanone;5Α-cholestanone;(5a;17b)-17-Octylandrostan-3-one;(5alpha)-Cholestan-3-one;(5alpha)-Cholestanone;5a(H)-Cholestan-3-one;5a-Cholestan-3-one;5alpha-Cholestane-3-one;5alpha-Coprostanone;Cop |
| Molecular Weight | 386.6535 |
| Formula | C27H46O |
| IUPAC | (1S;2S;7S;10R;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecan-5-one |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@@]4([H])CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C03238 |
| HMDB ID | HMDB0000871 |
| Melting Point (Degree C) | 128 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|