| Primary information |
|---|
| ID | 20429 |
| Pubchem ID | 222284 |
| Name | beta-Sitosterol |
| Description | beta-Sitosterol; a main dietary phytosterol found in plants; may have the potential for prevention and therapy for human cancer. Phytosterols are plant sterols found in foods such as oils; nuts; and vegetables. Phytosterols; in the same way as cholesterol; contain a double bond and are susceptible t |
| Synonym | (-)-beta-Sitosterol;(24R)-Ethylcholest-5-en-3beta-ol;(24R)-Stigmast-5-en-3beta-ol;(3beta)-Stigmast-5-en-3-ol;22;23-Dihydrostigmasterol;24alpha-Ethylcholesterol;alpha-Dihydrofucosterol;Azuprostat;beta- |
| Molecular Weight | 414.718 |
| Formula | C29H50O |
| IUPAC | (1S;2R;5S;10S;11S;14R;15R)-14-[(2R;5R)-5-ethyl-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-ol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CC[C@@H](CC)C(C)C |
| PDB ID | NA |
| KEGG | C01753 |
| HMDB ID | HMDB0000852 |
| Melting Point (Degree C) | 140 |
| Water Solubility | 10 mg/mL |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|