| Primary information |
|---|
| ID | 20426 |
| Pubchem ID | NA |
| Name | CE(16:1(9Z)) |
| Description | CE(16:1(9Z)); also known as (Z)-cholesterol 9-hexadecenoate or 1-palmitoleoyl-cholesterol; is an important plasma cholesteryl ester. A cholesteryl ester is an ester of cholesterol. Fatty acid esters of cholesterol constitute about two-thirds of the cholesterol in the plasma. |
| Synonym | (Z)-Cholesterol 9-hexadecenoate;(Z)-Cholesterol 9-hexadecenoic acid;1-Palmitoleoyl-cholesterol;16:1(9Z) Cholesterol ester;CE(16:1(9Z));CE(16:1/0:0);CE(16:1n7/0:0);CE(16:1W7/0:0);Cholesterol cis-9-hexa |
| Molecular Weight | 623.063 |
| Formula | C43H74O2 |
| IUPAC | (1S;2R;5S;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-yl (9Z)-hexadec-9-enoate |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@H](CC[C@]4(C)[C@@]3([H])CC[C@]12C)OC(=O)CCCCCCCC=C/CCCCCC)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000658 |
| Melting Point (Degree C) | NA |
| Water Solubility | 3.5e-20 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|