| Primary information |
|---|
| ID | 20425 |
| Pubchem ID | 65076 |
| Name | Cholesterol sulfate |
| Description | Cholesterol sulfate; or cholest-5-en-3beta-ol sulfate; is an endogenous steroid and the C3beta sulfate ester of cholesterol. It is formed from cholesterol by steroid sulfotransferases (SSTs) such as SULT2B1b (also known as cholesterol sulfotransferase) and is converted back into cholesterol by stero |
| Synonym | CHOLEST-5-en-3-yl hydrogen sulfATE;Cholest-5-en-3beta-ol sulfate;Cholesterol 3-sulfate;Cholesterol 3-sulphate;Cholesterol hydrogen sulfate;Cholesterol hydrogen sulphate;Cholesterol sulphate;Cholestery |
| Molecular Weight | 466.717 |
| Formula | C27H46O4S |
| IUPAC | [(1S;2R;5S;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-yl]oxidanesulfonic acid |
| SMILE | [H][C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@H](CC[C@]12C)OS(O)(=O)=O |
| PDB ID | NA |
| KEGG | C18043 |
| HMDB ID | HMDB0000653 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|