| Primary information |
|---|
| ID | 20424 |
| Pubchem ID | 457801 |
| Name | Clionasterol |
| Description | Clionasterol; also known as gamma-sitosterol or harzol; belongs to the class of organic compounds known as stigmastanes and derivatives. These are sterol lipids with a structure based on the stigmastane skeleton; which consists of a cholestane moiety bearing an ethyl group at the carbon atom C24. |
| Synonym | (3beta;24S)-Stigmast-5-en-3-ol;22;23-Dihydroporiferasterol;24-Ethylcholest-5-en-3 beta-ol;24beta-Ethyl-5-cholesten-3beta-ol;24beta-Ethylcholesterol;24S-Ethylcholest-5-en-3beta-ol;beta-Dihydrofucostero |
| Molecular Weight | 414.7067 |
| Formula | C29H50O |
| IUPAC | (1S;2R;5S;10S;11S;14R;15R)-14-[(2R;5S)-5-ethyl-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-ol |
| SMILE | [H][C@@]12CC[C@H]([C@H](C)CC[C@H](CC)C(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C19654 |
| HMDB ID | HMDB0000649 |
| Melting Point (Degree C) | 147 |
| Water Solubility | 4.6e-05 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|