| Primary information |
|---|
| ID | 20423 |
| Pubchem ID | 131801653 |
| Name | CE(18:2(9Z;12Z)) |
| Description | Cholesteryl linoleic acid is a cholesteryl ester. A cholesteryl ester is an ester of cholesterol. Fatty acid esters of cholesterol constitute about two-thirds of the cholesterol in the plasma. Cholesterol is a sterol (a combination steroid and alcohol) and a lipid found in the cell membranes of all |
| Synonym | Cholesterol ester(18:2);Cholesteryl 1-linoleoic acid;Cholesterol ester(18:2/0:0);Cholesterol 1-(9Z;12Z-octadecadienoate);Cholesteryl 1-(9Z;12Z-octadecadienoate);18:2(9Z;12Z) Cholesterol ester;Choleste |
| Molecular Weight | 649.101 |
| Formula | C45H76O2 |
| IUPAC | (2R;5S;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-yl (9Z;12Z)-octadeca-9;12-dienoate |
| SMILE | CCCCCC=C/CC=C/CCCCCCCC(=O)O[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(CCC4C3CC=C2C1)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C15441 |
| HMDB ID | HMDB0000610 |
| Melting Point (Degree C) | NA |
| Water Solubility | 1.7e-13 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|