| Primary information |
|---|
| ID | 20421 |
| Pubchem ID | 123675 |
| Name | 3;5-Diiodothyronine |
| Description | 3;5-Diiodothyronine; also known as 3;5-T2; belongs to the class of organic compounds known as phenylalanines and derivatives. Phenylalanine and derivatives are compounds containing phenylalanine or a derivative thereof resulting from reaction of phenylalanine at the amino group or the carboxy group |
| Synonym | 35-Diiodothyronine;(3;5-Diiodo-4-(-p-hydroxyphenoxy)phenyl)-alanine;3';5'-Diiodothyronine;3;5-Diiodo-D-thyronine;3;5-Diiodo-DL-thryronine;3;5-Diiodo-DL-thyronine;3;5-Diiodo-L-thyronine;3;5-T2;4-(4-Hyd |
| Molecular Weight | 525.077 |
| Formula | C15H13I2NO4 |
| IUPAC | 2-amino-3-[4-(4-hydroxyphenoxy)-3;5-diiodophenyl]propanoic acid |
| SMILE | NC(CC1=CC(I)=C(OC2=CC=C(O)C=C2)C(I)=C1)C(O)=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000582 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|