| Primary information |
|---|
| ID | 20420 |
| Pubchem ID | 221122 |
| Name | 5beta-Coprostanol |
| Description | Coprosterol or coprostanol is a cholesterol derivative found in human feces; gallstones; eggs; and other biological matter. Coprosterol is the odorous principle of feces. It is formed from the biohydrogenation of cholesterol (cholest-5en-3β-ol) in the gut of most higher animals and birds. |
| Synonym | (3beta;5beta)-Cholestan-3-ol;5beta Coprostanol;5beta-Cholestan-3beta-ol;Coprosterol;(3b;5b)-Cholestan-3-ol;(3Β;5β)-cholestan-3-ol;5b Coprostanol;5Β coprostanol;5b-Cholestan-3b-ol;5Β-cholestan-3β-ol;5b |
| Molecular Weight | 388.6694 |
| Formula | C27H48O |
| IUPAC | (1S;2S;5S;7R;10R;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecan-5-ol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@]4([H])C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000577 |
| Melting Point (Degree C) | 102 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|