| Primary information |
|---|
| ID | 20418 |
| Pubchem ID | 21252254 |
| Name | 5a-Cholestane-3a;7a;12a;23;25-pentol |
| Description | 5a-Cholestane-3a;7a;12a;23;25-pentol belongs to the class of organic compounds known as pentahydroxy bile acids; alcohols and derivatives. These are bile acids; alcohols or derivatives bearing five hydroxyl groups. Based on a literature review very few articles have been published on 5a-Cholestane-3 |
| Synonym | (3a;5a;7a;12a;23S)-Cholestane-3;7;12;23;25-pentol;(3a;5a;7a;12a;23S)-Cholestane-3;7;12;23;25-pentol; |
| Molecular Weight | 452.667 |
| Formula | C27H48O5 |
| IUPAC | (1S;2S;5R;7R;9R;10R;11S;14R;15R;16S)-14-[(2S)-4;6-dihydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;9;16-triol |
| SMILE | [H][C@@]12CC[C@H]([C@@H](C)CC(O)CC(C)(C)O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])[C@H](O)C[C@@]2([H])C[C@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000558 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|