| Primary information |
|---|
| ID | 20417 |
| Pubchem ID | 21252253 |
| Name | 5b-Cholestane-3a;7a;12a;24;25-pentol |
| Description | 5b-Cholestane-3a;7a;12a;24;25-pentol; also known as 3a;7a;12a;24;25-pentahydroxycoprostane; belongs to the class of organic compounds known as pentahydroxy bile acids; alcohols and derivatives. These are bile acids; alcohols or derivatives bearing five hydroxyl groups. |
| Synonym | 3a;7a;12a;24;25-Pentahydroxycoprostane;3alpha;7alpha;12alpha;24R;25-Pentahydroxy-5beta-cholestane;5beta-Cholestane-3alpha;7alpha;12alpha;24R;25-pentol;5b-Cholestane-3a;7a;12a;24R;25-pentol;5Β-cholesta |
| Molecular Weight | 452.667 |
| Formula | C27H48O5 |
| IUPAC | (1S;2S;5R;9R;10R;11S;14R;15R;16S)-14-[(2R)-5;6-dihydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;9;16-triol |
| SMILE | [H][C@@]12CC[C@H]([C@H](C)CCC(O)C(C)(C)O)[C@@]1(C)[C@@H](O)C[C@@]1([H])[C@@]2([H])[C@H](O)CC2C[C@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000556 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|