| Primary information |
|---|
| ID | 20416 |
| Pubchem ID | 15818 |
| Name | Dihydroandrosterone |
| Description | Dihydroandrosterone is a major metabolite of testosterone. Dihydroandrosterone is the main steroid produced by the immature ovary; at puberty the synthesis of steroids shifts toward 4-ene-3-oxo steroids. testosterone 5a-reduced metabolites; including dihydrotestosterone are produced in the anterior |
| Synonym | (3alpha;5alpha;17beta)-Androstane-3;17-diol;3alpha;17beta-Dihydroxy-5alpha-androstane;Hombreol;(3a;5a;17b)-Androstane-3;17-diol;(3Α;5α;17β)-androstane-3;17-diol;3a;17b-Dihydroxy-5a-androstane;3Α;17β-d |
| Molecular Weight | 292.4562 |
| Formula | C19H32O2 |
| IUPAC | (1S;2S;5R;7S;10R;11S;14S;15S)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;14-diol |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000554 |
| Melting Point (Degree C) | 219 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|