| Primary information |
|---|
| ID | 20415 |
| Pubchem ID | 134494 |
| Name | Etiocholanediol |
| Description | Etiocholanediol is one of the compounds tested to allow for the unequivocal identification of the presence of urinary anabolic steroids and metabolites banned for use in sport by athletes. In urine samples collected for anti-doping purposes with moderately elevated testosterone and epitestosterone r |
| Synonym | (3alpha;5beta;17beta)-Androstane-3;17-diol;3alpha;17beta-Dihydroxyetiocholane;(3a;5b;17b)-Androstane-3;17-diol;(3Α;5β;17β)-androstane-3;17-diol;3a;17b-Dihydroxyetiocholane;3Α;17β-dihydroxyetiocholane; |
| Molecular Weight | 292.4562 |
| Formula | C19H32O2 |
| IUPAC | (1S;2S;5R;7R;10R;11S;14S;15S)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;14-diol |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@]2([H])C[C@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000551 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|