| Primary information |
|---|
| ID | 20411 |
| Pubchem ID | 167758 |
| Name | 5beta-Cholestane-3alpha;7alpha;12alpha;25-tetrol |
| Description | 5β-Cholestane-3α;7α;12α;25-tetrol is an intermediate in the bile acid synthetic pathway; and is secreted into the bile and urine following glucuronidation. It does not undergo enterohepatic circulation. |
| Synonym | 5b-Cholestane-3a;7a;12a;25-tetrol;5Β-cholestane-3α;7α;12α;25-tetrol;5 beta Cholestane-3 alpha;7 alpha;12 alpha;25-tetrol;5 beta-Cholestane-3 beta;7 alpha;12 alpha;25-tetrol;Cholestane-3;7;12;25-tetrol |
| Molecular Weight | 436.677 |
| Formula | C27H48O4 |
| IUPAC | (1S;2S;5R;7S;9R;10R;11S;14R;15R;16S)-14-[(2R)-6-hydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;9;16-triol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CCCC(C)(C)O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000524 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|