| Primary information |
|---|
| ID | 20409 |
| Pubchem ID | 53477696 |
| Name | 7-Ketocholesterol |
| Description | 7-Ketocholesterol is a major oxidation product of cholesterol (oxysterol) found in human atherosclerotic plaque and is more atherogenic than cholesterol in some animal studies. Oxysterols (oxygenated forms of cholesterol) are present at low levels in the circulation and accumulate is plasma and tiss |
| Synonym | 3b-Hydroxycholest-5-en-7-one;7-Oxocholesterol;Cholest-5-en-3b-ol-7-one;Delta5-Cholesten-3b-ol-7-one;3beta-Hydroxy-5-cholestene-7-one;5-Cholesten-3 beta-ol-7-one;3b-Hydroxycholest-5-en-7-one;7-Oxochole |
| Molecular Weight | 400.6371 |
| Formula | C27H44O2 |
| IUPAC | (1S;2R;10S;11S;15R)-5-hydroxy-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-9-one |
| SMILE | [H][C@@]12CCC([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])C(=O)C=C2CC(O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000501 |
| Melting Point (Degree C) | 168 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|