| Primary information |
|---|
| ID | 20407 |
| Pubchem ID | 242332 |
| Name | 5alpha-Androstane-3beta;17beta-diol |
| Description | 5alpha-Androstane-3beta;17beta-diol; also known as 5-α-androstane-3-β;17β-diol or 3beta;17beta-dihydroxy-5alpha-androstane; belongs to the class of organic compounds known as androgens and derivatives. |
| Synonym | (3beta;5alpha;17beta)-Androstane-3;17-diol;3beta;17beta-Dihydroxy-5alpha-androstane;5-ALPHA-ANDROSTANE-3-BETA;17BETA-diol;5alpha-Androstan-3beta;17beta-diol;(3b;5a;17b)-Androstane-3;17-diol;(3Β;5α;17β |
| Molecular Weight | 292.4562 |
| Formula | C19H32O2 |
| IUPAC | (1S;2S;5S;7S;10R;11S;14S;15S)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;14-diol |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C12525 |
| HMDB ID | HMDB0000493 |
| Melting Point (Degree C) | NA |
| Water Solubility | 3 mg/mL |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|