| Primary information |
|---|
| ID | 20406 |
| Pubchem ID | 53477695 |
| Name | 5b-Cholestane-3a;7a;12a;23S;25-pentol |
| Description | 5b-Cholestane-3a;7a;12a;23S;25-pentol belongs to the class of organic compounds known as pentahydroxy bile acids; alcohols and derivatives. These are bile acids; alcohols or derivatives bearing five hydroxyl groups. |
| Synonym | (23S)-5b-Cholestane-3a;7a;12a;23;25-pentol;(3alpha;5beta;7alpha;12alpha;23S)-Cholestane-3;7;12;23;25-pentol;(23S)-5b-Cholestane-3a;7a;12a;23;25-pentol;(3alpha;5beta;7alpha;12alpha;23S)-Cholestane-3;7; |
| Molecular Weight | 452.667 |
| Formula | C27H48O5 |
| IUPAC | (1S;2S;5R;7S;9R;10R;15R;16S)-14-[(2S;4S)-4;6-dihydroxy-6-methylheptan-2-yl]-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecane-5;9;16-triol |
| SMILE | [H]C1CC([C@@H](C)C[C@H](O)CC(C)(C)O)[C@]2(C)C1[C@]1([H])[C@H](O)C[C@]3([H])C[C@H](O)CC[C@]3(C)[C@@]1([H])C[C@@H]2O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000483 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|