| Primary information |
|---|
| ID | 20405 |
| Pubchem ID | 9857254 |
| Name | 5alpha-Androstane-3alpha;17alpha-diol |
| Description | 5alpha-Androstane-3alpha;17a-diol belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favour the development of masculine characteristics. |
| Synonym | 5a-Androstane-3a;17a-diol;5Α-androstane-3α;17α-diol;3a;17a-Dihydroxy-5a-androstane;(3alpha;5alpha;17alpha)-Androstane-3;17-diol;(3Α;5α;17α)-androstane-3;17-diol;3alpha;17alpha-Dihydroxy-5alpha-androst |
| Molecular Weight | 292.4562 |
| Formula | C19H32O2 |
| IUPAC | (1S;2S;5R;7S;10R;11S;14R;15S)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;14-diol |
| SMILE | [H][C@@]12CC[C@@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000458 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|