| Primary information |
|---|
| ID | 20402 |
| Pubchem ID | 12895043 |
| Name | 24;25-Dihydroxyvitamin D |
| Description | 24;25-Dihydroxyvitamin D (24R;25(OH)2D3) circulates in blood at concentrations about 1000 times higher than 1alpha;25(OH)2D3. 24-Hydroxylase is present in the proximal convoluted tubule cells of the kidney and in virtual all target cells of 1alpha;25(OH)2D3. |
| Synonym | (3b;5Z;7E)-9;10-Secocholesta-5;7;10(19)-triene-3;24;25-triol;24;25-Dihydroxycholecalciferol;24;25-Dihydroxyvitamin;24;25-Dihydroxyvitamin D3;24-Hydroxycalcidiol;Vitamin D;24;25 Dihydroxyvitamin D3;(24 |
| Molecular Weight | 416.6365 |
| Formula | C27H44O3 |
| IUPAC | (6R)-6-[(1R;3aS;4E;7aR)-4-{2-[(1Z;5R)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene}-7a-methyl-octahydro-1H-inden-1-yl]-2-methylheptane-2;3-diol |
| SMILE | C[C@H](CCC(O)C(C)(C)O)[C@H]1CC[C@@]2([H])C(CCC[C@]12C)=CC=C1C[C@H](O)CCC1=C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000430 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|