| Primary information |
|---|
| ID | 20401 |
| Pubchem ID | 68570 |
| Name | 17alpha-Estradiol |
| Description | 17alpha-Estradiol (also known as 17alpha-E2; 17-epiestradiol) belongs to the class of organic compounds known as estrogens and derivatives. These are steroids with a structure containing a 3-hydroxylated estrane. |
| Synonym | Alfatradiol;alpha-Estradiol;Estra-1;3;5(10)trien-3;17alpha-diol;Estradiol-17alpha;a-Estradiol;Α-estradiol;Estra-1;3;5(10)trien-3;17a-diol;Estra-1;3;5(10)trien-3;17α-diol;Estradiol-17a;Estradiol-17α;17 |
| Molecular Weight | 272.382 |
| Formula | C18H24O2 |
| IUPAC | (1S;10R;11S;14R;15S)-15-methyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-triene-5;14-diol |
| SMILE | [H][C@@]12CC[C@@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3 |
| PDB ID | NA |
| KEGG | C02537 |
| HMDB ID | HMDB0000429 |
| Melting Point (Degree C) | 216 |
| Water Solubility | 0.0039 mg/mL |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|