| Primary information |
|---|
| ID | 20398 |
| Pubchem ID | 446934 |
| Name | 3beta;17alpha-Dihydroxy-5alpha-androstane |
| Description | 3beta;17alpha-Dihydroxy-5alpha-androstane is a steroid found in the monosulfate fraction of normal human feces. Several steroids identified in the disulfate fraction of human bile are found in the monosulfate fraction of human feces; indicating partial hydrolysis of diconjugates in the intestine. |
| Synonym | 5-ALPHA-ANDROSTANE-3-BETA;17-ALPHA-diol;5-a-ANDROSTANE-3-b;17-a-diol;5-Α-androstane-3-β;17-α-diol;3b;17a-Dihydroxy-5a-androstane;3Β;17α-dihydroxy-5α-androstane;5 Androstane 3;17 diol;5 alpha Androstan |
| Molecular Weight | 292.4562 |
| Formula | C19H32O2 |
| IUPAC | (1S;2S;5S;7S;10R;11S;14R;15S)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecane-5;14-diol |
| SMILE | [H][C@@]12CC[C@@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])C[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0000412 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|