| Primary information |
|---|
| ID | 20397 |
| Pubchem ID | 66417 |
| Name | 16-Ketoestradiol |
| Description | 16-Ketoestradiol is found in the estrogen patch. The estrogen patch is a delivery system for estradiol used as hormone replacement therapy to treat the symptoms of menopause; such as hot flashes and vaginal dryness; and to prevent osteoporosis. |
| Synonym | 16-oxo-17beta-Estradiol;16-oxo-17b-Estradiol;16-oxo-17Β-estradiol;1;3;5(10)-Estratriene-3;17b-diol-16-one;16-Keto-17b-estradiol;16-Oxoestradiol;16-Oxoestradiol-17b;3;17b-Dihydroxyestra-1;3;5(10)-trien |
| Molecular Weight | 286.3655 |
| Formula | C18H22O3 |
| IUPAC | (1S;10R;11S;14R;15S)-5;14-dihydroxy-15-methyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-2(7);3;5-trien-13-one |
| SMILE | [H][C@@]12CC(=O)[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3 |
| PDB ID | NA |
| KEGG | C14383 |
| HMDB ID | HMDB0000406 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|