| Primary information |
|---|
| ID | 20396 |
| Pubchem ID | 66414 |
| Name | 2-Methoxyestradiol |
| Description | 2-Methoxyestradiol (2ME2) is a drug that prevents the formation of new blood vessels that tumours need in order to grow (angiogenesis). |
| Synonym | 1;3;5(10)-ESTRATRIEN-2;3;17-BETA-triol 2-methyl ether;2-Hydroxyestradol 2-methyl ether;2-Methoxyestradiol-17beta;Panzem;1;3;5(10)-ESTRATRIEN-2;3;17-b-triol 2-methyl ether;1;3;5(10)-ESTRATRIEN-2;3;17-β |
| Molecular Weight | 302.4079 |
| Formula | C19H26O3 |
| IUPAC | (1S;10R;11S;14S;15S)-4-methoxy-15-methyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-triene-5;14-diol |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C(OC)=C3 |
| PDB ID | NA |
| KEGG | C05302 |
| HMDB ID | HMDB0000405 |
| Melting Point (Degree C) | 189 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|