| Primary information |
|---|
| ID | 20395 |
| Pubchem ID | 53477690 |
| Name | 3a;17a-Dihydroxy-5b-androstane |
| Description | 3a;17a-Dihydroxy-5b-androstane; also known as 5b-androstane-3a;17a-diol or 3;7-dharn-17-one; belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. |
| Synonym | 3 alpha;5 beta;7 alpha-3;7-Dihydroxyandrostan-17-one;5b-Androstane-3a;17a-diol;3;7-DHARN-17-one;3;7-Dihydroxyandrostan-17-one; (3beta;5beta;7beta)-isomer;3;7-Dihydroxyandrostan-17-one; (3beta;5alpha;7 |
| Molecular Weight | 292.4562 |
| Formula | C19H32O2 |
| IUPAC | (2S;5R;14R;15S)-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecane-5;14-diol |
| SMILE | C[C@]12CCC3C(CCC4C[C@H](O)CC[C@]34C)C1CC[C@H]2O |
| PDB ID | NA |
| KEGG | C07632 |
| HMDB ID | HMDB0000383 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|